C28H33BNO+ — CID 101174990
(3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium (PubChem CID 101174990) has the molecular formula C28H33BNO+ and a molecular weight of 410.39 g/mol. Its IUPAC name is (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium.
| Compound Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
|---|---|
| PubChem CID | 101174990 |
| Molecular Formula | C28H33BNO+ |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
| SMILES | Cc1cc(C)cc(C2(c3cc(C)cc(C)c3)OB(c3ccccc3C)[NH+]3CCC[C@H]32)c1 |
| InChI | InChI=1S/C28H32BNO/c1-19-13-20(2)16-24(15-19)28(25-17-21(3)14-22(4)18-25)27-11-8-12-30(27)29(31-28)26-10-7-6-9-23(26)5/h6-7,9-10,13-18,27H,8,11-12H2,1-5H3/p+1/t27-/m0/s1 |
| InChIKey | LYTFKTJBOMUAIR-MHZLTWQESA-O |
| XLogP | 3.95 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|