C38H50O2 — CID 101175562
(7S,8S,11S,20S,21S,24S,25S,28R)-7,25-dimethyl-8,24-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,4(12),13,15,18,26-heptaene (PubChem CID 101175562) has the molecular formula C38H50O2 and a molecular weight of 538.82 g/mol. Its IUPAC name is (7S,8S,11S,20S,21S,24S,25S,28R)-7,25-dimethyl-8,24-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,4(12),13,15,18,26-heptaene.
| Compound Name | (7S,8S,11S,20S,21S,24S,25S,28R)-7,25-dimethyl-8,24-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,4(12),13,15,18,26-heptaene |
|---|---|
| PubChem CID | 101175562 |
| Molecular Formula | C38H50O2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | (7S,8S,11S,20S,21S,24S,25S,28R)-7,25-dimethyl-8,24-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,4(12),13,15,18,26-heptaene |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2[C@@H]3C=Cc4cc5ccc6c(c5cc4[C@@H]3C=C[C@]12C)CC[C@]1(C)[C@@H](OC(C)(C)C)CC[C@@H]61 |
| InChI | InChI=1S/C38H50O2/c1-35(2,3)39-33-15-13-31-27-11-9-23-21-24-10-12-28-26(30(24)22-29(23)25(27)17-19-37(31,33)7)18-20-38(8)32(28)14-16-34(38)40-36(4,5)6/h9-12,17,19,21-22,25,27,31-34H,13-16,18,20H2,1-8H3/t25-,27-,31+,32+,33+,34+,37+,38+/m1/s1 |
| InChIKey | AFDVUEOYVQPRSO-PPHPCVJKSA-N |
| XLogP | 9.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|