C15H22O4 — CID 101176263
ethyl (E)-6-[3-(2-hydroxyethoxy)cyclopenta-1,3-dien-1-yl]hex-2-enoate (PubChem CID 101176263) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl (E)-6-[3-(2-hydroxyethoxy)cyclopenta-1,3-dien-1-yl]hex-2-enoate.
| Compound Name | ethyl (E)-6-[3-(2-hydroxyethoxy)cyclopenta-1,3-dien-1-yl]hex-2-enoate |
|---|---|
| PubChem CID | 101176263 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl (E)-6-[3-(2-hydroxyethoxy)cyclopenta-1,3-dien-1-yl]hex-2-enoate |
| SMILES | CCOC(=O)/C=C/CCCC1=CC(OCCO)=CC1 |
| InChI | InChI=1S/C15H22O4/c1-2-18-15(17)7-5-3-4-6-13-8-9-14(12-13)19-11-10-16/h5,7,9,12,16H,2-4,6,8,10-11H2,1H3/b7-5+ |
| InChIKey | FSTCTCSJGDPORS-FNORWQNLSA-N |
| XLogP | 2.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|