C18H18O2 — CID 101177767
(15R,16R)-15-(hydroxymethyl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-ol (PubChem CID 101177767) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (15R,16R)-15-(hydroxymethyl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-ol.
| Compound Name | (15R,16R)-15-(hydroxymethyl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-ol |
|---|---|
| PubChem CID | 101177767 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (15R,16R)-15-(hydroxymethyl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-ol |
| SMILES | C[C@@H]1C2c3ccccc3C(O)(c3ccccc32)[C@H]1CO |
| InChI | InChI=1S/C18H18O2/c1-11-16(10-19)18(20)14-8-4-2-6-12(14)17(11)13-7-3-5-9-15(13)18/h2-9,11,16-17,19-20H,10H2,1H3/t11-,16-,17?,18?/m0/s1 |
| InChIKey | UWNPWGJZVJKXHP-GUUKOKDOSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |