About [(4-methylbenzoyl)amino] propanimidate
[(4-methylbenzoyl)amino] propanimidate (PubChem CID 101177941) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is [(4-methylbenzoyl)amino] propanimidate.
Molecular Properties
| Compound Name | [(4-methylbenzoyl)amino] propanimidate |
| PubChem CID | 101177941 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(4-methylbenzoyl)amino] propanimidate |
| SMILES | [H]/N=C(\CC)ONC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H14N2O2/c1-3-10(12)15-13-11(14)9-6-4-8(2)5-7-9/h4-7,12H,3H2,1-2H3,(H,13,14)/b12-10+ |
| InChIKey | IZRYORAWAJOKIJ-ZRDIBKRKSA-N |
| XLogP | 2.04 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-methylbenzoyl)amino] propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylbenzoyl)amino] propanimidate?
The IUPAC name of [(4-methylbenzoyl)amino] propanimidate (CID 101177941) is [(4-methylbenzoyl)amino] propanimidate.
What is the SMILES notation for [(4-methylbenzoyl)amino] propanimidate?
The canonical SMILES for [(4-methylbenzoyl)amino] propanimidate is [H]/N=C(\CC)ONC(=O)c1ccc(C)cc1.
What is the InChIKey of [(4-methylbenzoyl)amino] propanimidate?
The InChIKey is IZRYORAWAJOKIJ-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-3-10(12)15-13-11(14)9-6-4-8(2)5-7-9/h4-7,12H,3H2,1-2H3,(H,13,14)/b12-10+.
What are the key properties of [(4-methylbenzoyl)amino] propanimidate?
[(4-methylbenzoyl)amino] propanimidate has a molecular weight of 206.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylbenzoyl)amino] propanimidate is sourced from PubChem (CID 101177941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).