About [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate
[(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate (PubChem CID 18530198) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate.
Molecular Properties
| Compound Name | [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate |
| PubChem CID | 18530198 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate |
| SMILES | C/C(=C/C(=O)ONC(=O)c1ccc(C)cc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-4-8-16(9-5-13)19(23)21-24-18(22)12-15(3)20-17-10-6-14(2)7-11-17/h4-12,20H,1-3H3,(H,21,23)/b15-12- |
| InChIKey | NYPKCAVYFWBLQG-QINSGFPZSA-N |
| XLogP | 3.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate?
The IUPAC name of [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate (CID 18530198) is [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate.
What is the SMILES notation for [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate?
The canonical SMILES for [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate is C/C(=C/C(=O)ONC(=O)c1ccc(C)cc1)Nc1ccc(C)cc1.
What is the InChIKey of [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate?
The InChIKey is NYPKCAVYFWBLQG-QINSGFPZSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-13-4-8-16(9-5-13)19(23)21-24-18(22)12-15(3)20-17-10-6-14(2)7-11-17/h4-12,20H,1-3H3,(H,21,23)/b15-12-.
What are the key properties of [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate?
[(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate has a molecular weight of 324.38 g/mol, XLogP of 3.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylbenzoyl)amino] (Z)-3-(4-methylanilino)but-2-enoate is sourced from PubChem (CID 18530198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).