About [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate
[(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate (PubChem CID 18530201) has the molecular formula C17H15N3O5
and a molecular weight of 341.32 g/mol. Its IUPAC name is [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate.
Molecular Properties
| Compound Name | [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate |
| PubChem CID | 18530201 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate |
| SMILES | C/C(=C/C(=O)ONC(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3O5/c1-12(18-14-5-3-2-4-6-14)11-16(21)25-19-17(22)13-7-9-15(10-8-13)20(23)24/h2-11,18H,1H3,(H,19,22)/b12-11- |
| InChIKey | NWJCPBVQCFBUIG-QXMHVHEDSA-N |
| XLogP | 2.80 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate?
The IUPAC name of [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate (CID 18530201) is [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate.
What is the SMILES notation for [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate?
The canonical SMILES for [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate is C/C(=C/C(=O)ONC(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccccc1.
What is the InChIKey of [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate?
The InChIKey is NWJCPBVQCFBUIG-QXMHVHEDSA-N. The full InChI is InChI=1S/C17H15N3O5/c1-12(18-14-5-3-2-4-6-14)11-16(21)25-19-17(22)13-7-9-15(10-8-13)20(23)24/h2-11,18H,1H3,(H,19,22)/b12-11-.
What are the key properties of [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate?
[(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate has a molecular weight of 341.32 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-nitrobenzoyl)amino] (Z)-3-anilinobut-2-enoate is sourced from PubChem (CID 18530201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).