C14H18O — CID 101178102
1-methyl-2-(2-methylprop-2-enoxy)-3-prop-2-enylbenzene (PubChem CID 101178102) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-methyl-2-(2-methylprop-2-enoxy)-3-prop-2-enylbenzene.
| Compound Name | 1-methyl-2-(2-methylprop-2-enoxy)-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 101178102 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-methyl-2-(2-methylprop-2-enoxy)-3-prop-2-enylbenzene |
| SMILES | C=CCc1cccc(C)c1OCC(=C)C |
| InChI | InChI=1S/C14H18O/c1-5-7-13-9-6-8-12(4)14(13)15-10-11(2)3/h5-6,8-9H,1-2,7,10H2,3-4H3 |
| InChIKey | JDNYBYIWYVAZFY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|