C34H48MgN2O6 — CID 101178456
magnesium;(2S)-2-(octanoylamino)-3-phenylpropanoic acid;(2S)-2-(1-oxidooctylideneamino)-3-phenylpropanoate (PubChem CID 101178456) has the molecular formula C34H48MgN2O6 and a molecular weight of 605.07 g/mol. Its IUPAC name is magnesium;(2S)-2-(octanoylamino)-3-phenylpropanoic acid;(2S)-2-(1-oxidooctylideneamino)-3-phenylpropanoate.
| Compound Name | magnesium;(2S)-2-(octanoylamino)-3-phenylpropanoic acid;(2S)-2-(1-oxidooctylideneamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101178456 |
| Molecular Formula | C34H48MgN2O6 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | magnesium;(2S)-2-(octanoylamino)-3-phenylpropanoic acid;(2S)-2-(1-oxidooctylideneamino)-3-phenylpropanoate |
| SMILES | CCCCCCC/C([O-])=N/[C@@H](Cc1ccccc1)C(=O)[O-].CCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O.[Mg+2] |
| InChI | InChI=1S/2C17H25NO3.Mg/c2*1-2-3-4-5-9-12-16(19)18-15(17(20)21)13-14-10-7-6-8-11-14;/h2*6-8,10-11,15H,2-5,9,12-13H2,1H3,(H,18,19)(H,20,21);/q;;+2/p-2/t2*15-;/m00./s1 |
| InChIKey | PBTPCIDCBLMYHV-ZFQYHYQMSA-L |
| XLogP | 4.25 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|