C19H36O2Si — CID 101179862
tert-butyl-[(2R,4R,6S)-2-ethenyl-6-[(E)-hex-1-enyl]oxan-4-yl]oxy-dimethylsilane (PubChem CID 101179862) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is tert-butyl-[(2R,4R,6S)-2-ethenyl-6-[(E)-hex-1-enyl]oxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-6-[(E)-hex-1-enyl]oxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101179862 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-6-[(E)-hex-1-enyl]oxan-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](/C=C/CCCC)O1 |
| InChI | InChI=1S/C19H36O2Si/c1-8-10-11-12-13-17-15-18(14-16(9-2)20-17)21-22(6,7)19(3,4)5/h9,12-13,16-18H,2,8,10-11,14-15H2,1,3-7H3/b13-12+/t16-,17+,18+/m0/s1 |
| InChIKey | SUCWBNPBLRVNLH-PHCFSIKCSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|