C9H16O4S — CID 101181650
methyl (3R,4R)-4-(methoxymethoxy)thiane-3-carboxylate (PubChem CID 101181650) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is methyl (3R,4R)-4-(methoxymethoxy)thiane-3-carboxylate.
| Compound Name | methyl (3R,4R)-4-(methoxymethoxy)thiane-3-carboxylate |
|---|---|
| PubChem CID | 101181650 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl (3R,4R)-4-(methoxymethoxy)thiane-3-carboxylate |
| SMILES | COCO[C@@H]1CCSC[C@H]1C(=O)OC |
| InChI | InChI=1S/C9H16O4S/c1-11-6-13-8-3-4-14-5-7(8)9(10)12-2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | HCRHSJYBTVWZOO-HTQZYQBOSA-N |
| XLogP | 0.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|