C13H18O6S2 — CID 11142219
S-[3-acetylsulfanyl-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propyl] ethanethioate (PubChem CID 11142219) has the molecular formula C13H18O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is S-[3-acetylsulfanyl-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propyl] ethanethioate.
| Compound Name | S-[3-acetylsulfanyl-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 11142219 |
| Molecular Formula | C13H18O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | S-[3-acetylsulfanyl-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCCC(SC(C)=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H18O6S2/c1-7(14)20-6-5-9(21-8(2)15)10-11(16)18-13(3,4)19-12(10)17/h9-10H,5-6H2,1-4H3 |
| InChIKey | SCTNTQHSEIAZHW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|