C9H14O4S — CID 142888071
2,2-dimethyl-5-(3-sulfanylpropyl)-1,3-dioxane-4,6-dione (PubChem CID 142888071) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-sulfanylpropyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-sulfanylpropyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 142888071 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2,2-dimethyl-5-(3-sulfanylpropyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CCCS)C(=O)O1 |
| InChI | InChI=1S/C9H14O4S/c1-9(2)12-7(10)6(4-3-5-14)8(11)13-9/h6,14H,3-5H2,1-2H3 |
| InChIKey | HKOCQIOSNQCAKE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|