C11H14O6S — CID 10683708
S-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl] ethanethioate (PubChem CID 10683708) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is S-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl] ethanethioate.
| Compound Name | S-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 10683708 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | S-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)SCCC(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C11H14O6S/c1-6(12)18-5-4-7(13)8-9(14)16-11(2,3)17-10(8)15/h8H,4-5H2,1-3H3 |
| InChIKey | UDSDXVUHLCEROI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|