C21H35ClN2Si — CID 101182363
2-[4-chloro-1-tri(propan-2-yl)silylindol-3-yl]-N,N-dimethylethanamine (PubChem CID 101182363) has the molecular formula C21H35ClN2Si and a molecular weight of 379.06 g/mol. Its IUPAC name is 2-[4-chloro-1-tri(propan-2-yl)silylindol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-chloro-1-tri(propan-2-yl)silylindol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 101182363 |
| Molecular Formula | C21H35ClN2Si |
| Molecular Weight | 379.06 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[4-chloro-1-tri(propan-2-yl)silylindol-3-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(CCN(C)C)c2c(Cl)cccc21 |
| InChI | InChI=1S/C21H35ClN2Si/c1-15(2)25(16(3)4,17(5)6)24-14-18(12-13-23(7)8)21-19(22)10-9-11-20(21)24/h9-11,14-17H,12-13H2,1-8H3 |
| InChIKey | FKRNPJLIKJWOCJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|