C13H8IN2NaO5S — CID 101186225
sodium (6R,7E)-3-iodo-5,5,8-trioxo-7-(pyridin-2-ylmethylidene)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 101186225) has the molecular formula C13H8IN2NaO5S and a molecular weight of 454.18 g/mol. Its IUPAC name is sodium (6R,7E)-3-iodo-5,5,8-trioxo-7-(pyridin-2-ylmethylidene)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R,7E)-3-iodo-5,5,8-trioxo-7-(pyridin-2-ylmethylidene)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 101186225 |
| Molecular Formula | C13H8IN2NaO5S |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 453.91 |
| IUPAC Name | sodium (6R,7E)-3-iodo-5,5,8-trioxo-7-(pyridin-2-ylmethylidene)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C([O-])C1=C(I)CS(=O)(=O)[C@@H]2/C(=C/c3ccccn3)C(=O)N12.[Na+] |
| InChI | InChI=1S/C13H9IN2O5S.Na/c14-9-6-22(20,21)12-8(5-7-3-1-2-4-15-7)11(17)16(12)10(9)13(18)19;/h1-5,12H,6H2,(H,18,19);/q;+1/p-1/b8-5+;/t12-;/m1./s1 |
| InChIKey | WCMOVGVFWREFBN-UTVAGPCJSA-M |
| XLogP | -3.54 |
| TPSA | 107.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|