C14H12N2O7S — CID 91481711
(2S,3R,5R)-3-methyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylic acid (PubChem CID 91481711) has the molecular formula C14H12N2O7S and a molecular weight of 352.32 g/mol. Its IUPAC name is (2S,3R,5R)-3-methyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylic acid.
| Compound Name | (2S,3R,5R)-3-methyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91481711 |
| Molecular Formula | C14H12N2O7S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2S,3R,5R)-3-methyl-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylic acid |
| SMILES | C[C@]1(C(=O)O)[C@H](C(=O)O)N2C(=O)C(=Cc3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C14H12N2O7S/c1-14(13(20)21)9(12(18)19)16-10(17)8(11(16)24(14,22)23)6-7-4-2-3-5-15-7/h2-6,9,11H,1H3,(H,18,19)(H,20,21)/t9-,11+,14+/m0/s1 |
| InChIKey | SHFWWYYXSZDCPQ-DRCTWCGVSA-N |
| XLogP | -0.64 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|