C18H18N2O7S — CID 59142421
(2S,5S,6Z)-3,3-dimethyl-4,4,7-trioxo-6-[(5-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 59142421) has the molecular formula C18H18N2O7S and a molecular weight of 406.42 g/mol. Its IUPAC name is (2S,5S,6Z)-3,3-dimethyl-4,4,7-trioxo-6-[(5-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5S,6Z)-3,3-dimethyl-4,4,7-trioxo-6-[(5-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 59142421 |
| Molecular Formula | C18H18N2O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2S,5S,6Z)-3,3-dimethyl-4,4,7-trioxo-6-[(5-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C=CCOC(=O)c1ccc(/C=C2/C(=O)N3[C@@H](C(=O)O)C(C)(C)S(=O)(=O)[C@@H]23)nc1 |
| InChI | InChI=1S/C18H18N2O7S/c1-4-7-27-17(24)10-5-6-11(19-9-10)8-12-14(21)20-13(16(22)23)18(2,3)28(25,26)15(12)20/h4-6,8-9,13,15H,1,7H2,2-3H3,(H,22,23)/b12-8-/t13-,15-/m0/s1 |
| InChIKey | FAUYIAAFJBJVHC-QFGWSVGLSA-N |
| XLogP | 0.64 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|