C19H20N2O5 — CID 158581304
(2R,6E)-3,3-dimethyl-7-oxo-6-[(4-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 158581304) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2R,6E)-3,3-dimethyl-7-oxo-6-[(4-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,6E)-3,3-dimethyl-7-oxo-6-[(4-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 158581304 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2R,6E)-3,3-dimethyl-7-oxo-6-[(4-prop-2-enoxycarbonyl-2-pyridinyl)methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C=CCOC(=O)c1ccnc(/C=C2/C(=O)N3C2CC(C)(C)[C@@H]3C(=O)O)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-4-7-26-18(25)11-5-6-20-12(8-11)9-13-14-10-19(2,3)15(17(23)24)21(14)16(13)22/h4-6,8-9,14-15H,1,7,10H2,2-3H3,(H,23,24)/b13-9+/t14?,15-/m0/s1 |
| InChIKey | JSPYRZKNZRVBKB-GVUSENKASA-N |
| XLogP | 1.90 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|