C22H21N3O8S — CID 44624479
(2S,5R,6Z)-6-[[4-[(3,4-dihydroxyphenyl)methylcarbamoyl]-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624479) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is (2S,5R,6Z)-6-[[4-[(3,4-dihydroxyphenyl)methylcarbamoyl]-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6Z)-6-[[4-[(3,4-dihydroxyphenyl)methylcarbamoyl]-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624479 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (2S,5R,6Z)-6-[[4-[(3,4-dihydroxyphenyl)methylcarbamoyl]-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C/c3cc(C(=O)NCc4ccc(O)c(O)c4)ccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C22H21N3O8S/c1-22(2)17(21(30)31)25-19(29)14(20(25)34(22,32)33)9-13-8-12(5-6-23-13)18(28)24-10-11-3-4-15(26)16(27)7-11/h3-9,17,20,26-27H,10H2,1-2H3,(H,24,28)(H,30,31)/b14-9-/t17-,20+/m0/s1 |
| InChIKey | KYGXKZGXLJBYES-FSBBVQABSA-N |
| XLogP | 0.63 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|