C17H20N4O6S — CID 44624689
(2S,5R,6Z)-6-[[3-(2-aminoethylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 44624689) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is (2S,5R,6Z)-6-[[3-(2-aminoethylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6Z)-6-[[3-(2-aminoethylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 44624689 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (2S,5R,6Z)-6-[[3-(2-aminoethylcarbamoyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)/C(=C/c3ncccc3C(=O)NCCN)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C17H20N4O6S/c1-17(2)12(16(24)25)21-14(23)10(15(21)28(17,26)27)8-11-9(4-3-6-19-11)13(22)20-7-5-18/h3-4,6,8,12,15H,5,7,18H2,1-2H3,(H,20,22)(H,24,25)/b10-8-/t12-,15+/m0/s1 |
| InChIKey | QZRIODOMLBXLDI-DFHPSLQESA-N |
| XLogP | -1.02 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|