C18H36OSi — CID 101186824
tri(propan-2-yl)-[(1R,2S)-2-prop-1-en-2-ylcyclohexyl]oxysilane (PubChem CID 101186824) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tri(propan-2-yl)-[(1R,2S)-2-prop-1-en-2-ylcyclohexyl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(1R,2S)-2-prop-1-en-2-ylcyclohexyl]oxysilane |
|---|---|
| PubChem CID | 101186824 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tri(propan-2-yl)-[(1R,2S)-2-prop-1-en-2-ylcyclohexyl]oxysilane |
| SMILES | C=C(C)[C@@H]1CCCC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36OSi/c1-13(2)17-11-9-10-12-18(17)19-20(14(3)4,15(5)6)16(7)8/h14-18H,1,9-12H2,2-8H3/t17-,18+/m0/s1 |
| InChIKey | DHHVYFUNPDTJSB-ZWKOTPCHSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|