C14H26OSSi — CID 101187408
[(1Z)-1-cyclohexylsulfanyl-2-methylbuta-1,3-dienoxy]-trimethylsilane (PubChem CID 101187408) has the molecular formula C14H26OSSi and a molecular weight of 270.51 g/mol. Its IUPAC name is [(1Z)-1-cyclohexylsulfanyl-2-methylbuta-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1Z)-1-cyclohexylsulfanyl-2-methylbuta-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101187408 |
| Molecular Formula | C14H26OSSi |
| Molecular Weight | 270.51 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(1Z)-1-cyclohexylsulfanyl-2-methylbuta-1,3-dienoxy]-trimethylsilane |
| SMILES | C=C/C(C)=C(/O[Si](C)(C)C)SC1CCCCC1 |
| InChI | InChI=1S/C14H26OSSi/c1-6-12(2)14(15-17(3,4)5)16-13-10-8-7-9-11-13/h6,13H,1,7-11H2,2-5H3/b14-12- |
| InChIKey | GYJCNQMJMCKDPL-OWBHPGMISA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|