C17H14F4N2O3S — CID 101190966
methyl 4-[(3R)-2-(4-fluorophenyl)-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl]benzenesulfonate (PubChem CID 101190966) has the molecular formula C17H14F4N2O3S and a molecular weight of 402.37 g/mol. Its IUPAC name is methyl 4-[(3R)-2-(4-fluorophenyl)-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl]benzenesulfonate.
| Compound Name | methyl 4-[(3R)-2-(4-fluorophenyl)-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl]benzenesulfonate |
|---|---|
| PubChem CID | 101190966 |
| Molecular Formula | C17H14F4N2O3S |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | methyl 4-[(3R)-2-(4-fluorophenyl)-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl]benzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc([C@H]2CC(C(F)(F)F)=NN2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14F4N2O3S/c1-26-27(24,25)14-8-2-11(3-9-14)15-10-16(17(19,20)21)22-23(15)13-6-4-12(18)5-7-13/h2-9,15H,10H2,1H3/t15-/m1/s1 |
| InChIKey | VBIXKJRYVIQFGV-OAHLLOKOSA-N |
| XLogP | 4.03 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|