C24H24F8N4O3S — CID 142733761
2-[2-(2,4-difluorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 142733761) has the molecular formula C24H24F8N4O3S and a molecular weight of 600.53 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2,4-difluorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 142733761 |
| Molecular Formula | C24H24F8N4O3S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-3-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C24H24F8N4O3S/c1-2-40(38,39)35-11-9-34(10-12-35)17-6-3-15(4-7-17)20-14-21(22(37,23(27,28)29)24(30,31)32)33-36(20)19-8-5-16(25)13-18(19)26/h3-8,13,20,37H,2,9-12,14H2,1H3 |
| InChIKey | FOXILVBUINDTRD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|