C22H19F8N3 — CID 118432146
1-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]-2-fluorophenyl]piperidine (PubChem CID 118432146) has the molecular formula C22H19F8N3 and a molecular weight of 477.40 g/mol. Its IUPAC name is 1-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]-2-fluorophenyl]piperidine.
| Compound Name | 1-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]-2-fluorophenyl]piperidine |
|---|---|
| PubChem CID | 118432146 |
| Molecular Formula | C22H19F8N3 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]-2-fluorophenyl]piperidine |
| SMILES | Fc1ccc(N2N=C(C(F)(F)C(F)(F)F)CC2c2ccc(F)c(N3CCCCC3)c2)c(F)c1 |
| InChI | InChI=1S/C22H19F8N3/c23-14-5-7-17(16(25)11-14)33-18(12-20(31-33)21(26,27)22(28,29)30)13-4-6-15(24)19(10-13)32-8-2-1-3-9-32/h4-7,10-11,18H,1-3,8-9,12H2 |
| InChIKey | JOBDVCRXGSJFHC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|