C24H25F7N4O2S — CID 118431978
tert-butyl 4-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]thiophen-2-yl]piperazine-1-carboxylate (PubChem CID 118431978) has the molecular formula C24H25F7N4O2S and a molecular weight of 566.54 g/mol. Its IUPAC name is tert-butyl 4-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]thiophen-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]thiophen-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118431978 |
| Molecular Formula | C24H25F7N4O2S |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | tert-butyl 4-[5-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]thiophen-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccc(F)cc3F)s2)CC1 |
| InChI | InChI=1S/C24H25F7N4O2S/c1-22(2,3)37-21(36)34-10-8-33(9-11-34)20-7-6-18(38-20)17-13-19(23(27,28)24(29,30)31)32-35(17)16-5-4-14(25)12-15(16)26/h4-7,12,17H,8-11,13H2,1-3H3 |
| InChIKey | AQAJNLPEXSBAFA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|