C27H26F7N3O2 — CID 118432080
tert-butyl 4-[3-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118432080) has the molecular formula C27H26F7N3O2 and a molecular weight of 557.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118432080 |
| Molecular Formula | C27H26F7N3O2 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | tert-butyl 4-[3-[2-(2,4-difluorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccc(F)cc3F)c2)CC1 |
| InChI | InChI=1S/C27H26F7N3O2/c1-25(2,3)39-24(38)36-11-9-16(10-12-36)17-5-4-6-18(13-17)22-15-23(26(30,31)27(32,33)34)35-37(22)21-8-7-19(28)14-20(21)29/h4-9,13-14,22H,10-12,15H2,1-3H3 |
| InChIKey | AEMXHBNOCNMJHE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|