C26H22ClF6N3O3S — CID 142733664
4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 142733664) has the molecular formula C26H22ClF6N3O3S and a molecular weight of 605.99 g/mol. Its IUPAC name is 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 142733664 |
| Molecular Formula | C26H22ClF6N3O3S |
| Molecular Weight | 605.99 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 4-[4-[2-(2-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydropyrazol-3-yl]phenyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22ClF6N3O3S/c1-35(2)40(38,39)19-13-11-17(12-14-19)16-7-9-18(10-8-16)22-15-23(24(37,25(28,29)30)26(31,32)33)34-36(22)21-6-4-3-5-20(21)27/h3-14,22,37H,15H2,1-2H3 |
| InChIKey | NPFXKRISHBDCJH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.99 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |