C27H23ClF6N2O — CID 142733722
2-[2-(2-chlorophenyl)-3-[4-(2-propan-2-ylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 142733722) has the molecular formula C27H23ClF6N2O and a molecular weight of 540.94 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(2-propan-2-ylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(2-propan-2-ylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 142733722 |
| Molecular Formula | C27H23ClF6N2O |
| Molecular Weight | 540.94 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(2-propan-2-ylphenyl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)c1ccccc1-c1ccc(C2CC(C(O)(C(F)(F)F)C(F)(F)F)=NN2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H23ClF6N2O/c1-16(2)19-7-3-4-8-20(19)17-11-13-18(14-12-17)23-15-24(25(37,26(29,30)31)27(32,33)34)35-36(23)22-10-6-5-9-21(22)28/h3-14,16,23,37H,15H2,1-2H3 |
| InChIKey | YOPYKJOWTQVIHE-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.94 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |