C28H25ClF6N2O — CID 142733661
2-[3-[4-(4-tert-butylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 142733661) has the molecular formula C28H25ClF6N2O and a molecular weight of 554.96 g/mol. Its IUPAC name is 2-[3-[4-(4-tert-butylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[4-(4-tert-butylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 142733661 |
| Molecular Formula | C28H25ClF6N2O |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 2-[3-[4-(4-tert-butylphenyl)phenyl]-2-(2-chlorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(C)c1ccc(-c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H25ClF6N2O/c1-25(2,3)20-14-12-18(13-15-20)17-8-10-19(11-9-17)23-16-24(26(38,27(30,31)32)28(33,34)35)36-37(23)22-7-5-4-6-21(22)29/h4-15,23,38H,16H2,1-3H3 |
| InChIKey | SYTGOTAZPMVQKO-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |