C24H18ClF5N2OS — CID 142733545
2-(2-chlorophenyl)-3-[4-(2-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole (PubChem CID 142733545) has the molecular formula C24H18ClF5N2OS and a molecular weight of 512.93 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[4-(2-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole.
| Compound Name | 2-(2-chlorophenyl)-3-[4-(2-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 142733545 |
| Molecular Formula | C24H18ClF5N2OS |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[4-(2-methylsulfinylphenyl)phenyl]-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole |
| SMILES | CS(=O)c1ccccc1-c1ccc(C2CC(C(F)(F)C(F)(F)F)=NN2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H18ClF5N2OS/c1-34(33)21-9-5-2-6-17(21)15-10-12-16(13-11-15)20-14-22(23(26,27)24(28,29)30)31-32(20)19-8-4-3-7-18(19)25/h2-13,20H,14H2,1H3 |
| InChIKey | YSYYWOINKVSJMT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|