C22H30O2Si — CID 101192102
(2R,3R,4S)-2-benzyl-3-methoxy-4-phenyl-1-trimethylsilylpentan-1-one (PubChem CID 101192102) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is (2R,3R,4S)-2-benzyl-3-methoxy-4-phenyl-1-trimethylsilylpentan-1-one.
| Compound Name | (2R,3R,4S)-2-benzyl-3-methoxy-4-phenyl-1-trimethylsilylpentan-1-one |
|---|---|
| PubChem CID | 101192102 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2R,3R,4S)-2-benzyl-3-methoxy-4-phenyl-1-trimethylsilylpentan-1-one |
| SMILES | CO[C@@H]([C@@H](Cc1ccccc1)C(=O)[Si](C)(C)C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H30O2Si/c1-17(19-14-10-7-11-15-19)21(24-2)20(22(23)25(3,4)5)16-18-12-8-6-9-13-18/h6-15,17,20-21H,16H2,1-5H3/t17-,20+,21+/m0/s1 |
| InChIKey | HIXHDKYVMVBLHR-IOMROCGXSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|