C22H32O2Si — CID 11348849
(2S,3S,4R,5S)-4-methoxy-3,5-diphenyl-2-trimethylsilylhexan-2-ol (PubChem CID 11348849) has the molecular formula C22H32O2Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (2S,3S,4R,5S)-4-methoxy-3,5-diphenyl-2-trimethylsilylhexan-2-ol.
| Compound Name | (2S,3S,4R,5S)-4-methoxy-3,5-diphenyl-2-trimethylsilylhexan-2-ol |
|---|---|
| PubChem CID | 11348849 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2S,3S,4R,5S)-4-methoxy-3,5-diphenyl-2-trimethylsilylhexan-2-ol |
| SMILES | CO[C@H]([C@@H](C)c1ccccc1)[C@H](c1ccccc1)[C@@](C)(O)[Si](C)(C)C |
| InChI | InChI=1S/C22H32O2Si/c1-17(18-13-9-7-10-14-18)21(24-3)20(19-15-11-8-12-16-19)22(2,23)25(4,5)6/h7-17,20-21,23H,1-6H3/t17-,20-,21+,22-/m0/s1 |
| InChIKey | RSACDTIIICZPDR-MVWVFHAYSA-N |
| XLogP | 5.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|