C21H18Cl2O6 — CID 101192574
dimethyl 2,2-bis[2-(4-chlorophenyl)-2-oxoethyl]propanedioate (PubChem CID 101192574) has the molecular formula C21H18Cl2O6 and a molecular weight of 437.28 g/mol. Its IUPAC name is dimethyl 2,2-bis[2-(4-chlorophenyl)-2-oxoethyl]propanedioate.
| Compound Name | dimethyl 2,2-bis[2-(4-chlorophenyl)-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 101192574 |
| Molecular Formula | C21H18Cl2O6 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | dimethyl 2,2-bis[2-(4-chlorophenyl)-2-oxoethyl]propanedioate |
| SMILES | COC(=O)C(CC(=O)c1ccc(Cl)cc1)(CC(=O)c1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C21H18Cl2O6/c1-28-19(26)21(20(27)29-2,11-17(24)13-3-7-15(22)8-4-13)12-18(25)14-5-9-16(23)10-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | KAINKLQFVSJOLK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|