C11H16O3 — CID 101192912
(3aS,5R,7aR)-5-hydroxy-4,4,7a-trimethyl-3a,5-dihydro-3H-1-benzofuran-2-one (PubChem CID 101192912) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3aS,5R,7aR)-5-hydroxy-4,4,7a-trimethyl-3a,5-dihydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,5R,7aR)-5-hydroxy-4,4,7a-trimethyl-3a,5-dihydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 101192912 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3aS,5R,7aR)-5-hydroxy-4,4,7a-trimethyl-3a,5-dihydro-3H-1-benzofuran-2-one |
| SMILES | CC1(C)[C@H](O)C=C[C@@]2(C)OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C11H16O3/c1-10(2)7-6-9(13)14-11(7,3)5-4-8(10)12/h4-5,7-8,12H,6H2,1-3H3/t7-,8+,11+/m0/s1 |
| InChIKey | QMPUENMENUQYLB-VAOFZXAKSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|