C11H9F8NO — CID 101192932
3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-2,1-benzoxazole (PubChem CID 101192932) has the molecular formula C11H9F8NO and a molecular weight of 323.18 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-2,1-benzoxazole.
| Compound Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 101192932 |
| Molecular Formula | C11H9F8NO |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-4,5,6,7-tetrahydro-2,1-benzoxazole |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)c1onc2c1CCCC2 |
| InChI | InChI=1S/C11H9F8NO/c12-8(13)10(16,17)11(18,19)9(14,15)7-5-3-1-2-4-6(5)20-21-7/h8H,1-4H2 |
| InChIKey | VZWIJPYTYUDZKP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|