C13H8F13NO — CID 101192933
3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-2,1-benzoxazole (PubChem CID 101192933) has the molecular formula C13H8F13NO and a molecular weight of 441.19 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-2,1-benzoxazole.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 101192933 |
| Molecular Formula | C13H8F13NO |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5,6,7-tetrahydro-2,1-benzoxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1onc2c1CCCC2 |
| InChI | InChI=1S/C13H8F13NO/c14-8(15,7-5-3-1-2-4-6(5)27-28-7)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-4H2 |
| InChIKey | BXHNSVQAQOLUJT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|