C22H42LiO16P — CID 101192936
lithium 2,3-bis[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxy]propyl methyl phosphate (PubChem CID 101192936) has the molecular formula C22H42LiO16P and a molecular weight of 600.48 g/mol. Its IUPAC name is lithium 2,3-bis[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxy]propyl methyl phosphate.
| Compound Name | lithium 2,3-bis[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxy]propyl methyl phosphate |
|---|---|
| PubChem CID | 101192936 |
| Molecular Formula | C22H42LiO16P |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | lithium 2,3-bis[[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxy]propyl methyl phosphate |
| SMILES | COCCOCCOCCOCC(=O)OCC(COP(=O)([O-])OC)OC(=O)COCCOCCOCCOC.[Li+] |
| InChI | InChI=1S/C22H43O16P.Li/c1-27-4-6-30-8-10-32-12-14-34-18-21(23)36-16-20(17-37-39(25,26)29-3)38-22(24)19-35-15-13-33-11-9-31-7-5-28-2;/h20H,4-19H2,1-3H3,(H,25,26);/q;+1/p-1 |
| InChIKey | DXGZHGJJXHDFIC-UHFFFAOYSA-M |
| XLogP | -4.03 |
| TPSA | 185.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|