C11H14O7S — CID 101193524
[(2S,3S,4R)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-oxooxolan-3-yl] acetate (PubChem CID 101193524) has the molecular formula C11H14O7S and a molecular weight of 290.29 g/mol. Its IUPAC name is [(2S,3S,4R)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-oxooxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4R)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-oxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101193524 |
| Molecular Formula | C11H14O7S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [(2S,3S,4R)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-oxooxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](CSC(C)=O)OC(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H14O7S/c1-5(12)16-9-8(4-19-7(3)14)18-11(15)10(9)17-6(2)13/h8-10H,4H2,1-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | MYPSWEMVUXXQOF-OPRDCNLKSA-N |
| XLogP | 0.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|