C10H16O4S — CID 11195633
methyl (2S,3R)-3-pentylsulfanylcarbonyloxirane-2-carboxylate (PubChem CID 11195633) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl (2S,3R)-3-pentylsulfanylcarbonyloxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-pentylsulfanylcarbonyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 11195633 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | methyl (2S,3R)-3-pentylsulfanylcarbonyloxirane-2-carboxylate |
| SMILES | CCCCCSC(=O)[C@@H]1O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H16O4S/c1-3-4-5-6-15-10(12)8-7(14-8)9(11)13-2/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | PZVPLCXLKUDEFH-JGVFFNPUSA-N |
| XLogP | 1.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|