C16H32O3Sn — CID 15363581
methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate (PubChem CID 15363581) has the molecular formula C16H32O3Sn and a molecular weight of 391.14 g/mol. Its IUPAC name is methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 15363581 |
| Molecular Formula | C16H32O3Sn |
| Molecular Weight | 391.14 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H]1O[C@H]1C(=O)OC |
| InChI | InChI=1S/C4H5O3.3C4H9.Sn/c1-6-4(5)3-2-7-3;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3;/t3-;;;;/m1..../s1 |
| InChIKey | SDOYFJWSWBANCZ-ATESMDQDSA-N |
| XLogP | 4.32 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.14 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|