methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate

C16H32O3Sn — CID 15363581

IUPACmethyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)[C@@H]1O[C@H]1C(=O)OC
InChIInChI=1S/C4H5O3.3C4H9.Sn/c1-6-4(5)3-2-7-3;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3;/t3-;;;;/m1..../s1
InChIKeySDOYFJWSWBANCZ-ATESMDQDSA-N
MW391.14 g/mol
LogP4.32
Rot. Bonds11

About methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate

methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate (PubChem CID 15363581) has the molecular formula C16H32O3Sn and a molecular weight of 391.14 g/mol. Its IUPAC name is methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate
PubChem CID15363581
Molecular FormulaC16H32O3Sn
Molecular Weight391.14 g/mol
Exact Mass392.14
IUPAC Namemethyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)[C@@H]1O[C@H]1C(=O)OC
InChIInChI=1S/C4H5O3.3C4H9.Sn/c1-6-4(5)3-2-7-3;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3;/t3-;;;;/m1..../s1
InChIKeySDOYFJWSWBANCZ-ATESMDQDSA-N
XLogP4.32
TPSA38.83 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500391.14
LogP ≤ 54.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate?
The IUPAC name of methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate (CID 15363581) is methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate.
What is the SMILES notation for methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate?
The canonical SMILES for methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate is CCCC[Sn](CCCC)(CCCC)[C@@H]1O[C@H]1C(=O)OC.
What is the InChIKey of methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate?
The InChIKey is SDOYFJWSWBANCZ-ATESMDQDSA-N. The full InChI is InChI=1S/C4H5O3.3C4H9.Sn/c1-6-4(5)3-2-7-3;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3;/t3-;;;;/m1..../s1.
What are the key properties of methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate?
methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate has a molecular weight of 391.14 g/mol, XLogP of 4.32, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S)-3-tributylstannyloxirane-2-carboxylate is sourced from PubChem (CID 15363581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).