C14H26O4 — CID 143946985
methyl 3-(4-hydroxy-3,3-dimethyloctyl)oxirane-2-carboxylate (PubChem CID 143946985) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-3,3-dimethyloctyl)oxirane-2-carboxylate.
| Compound Name | methyl 3-(4-hydroxy-3,3-dimethyloctyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 143946985 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | methyl 3-(4-hydroxy-3,3-dimethyloctyl)oxirane-2-carboxylate |
| SMILES | CCCCC(O)C(C)(C)CCC1OC1C(=O)OC |
| InChI | InChI=1S/C14H26O4/c1-5-6-7-11(15)14(2,3)9-8-10-12(18-10)13(16)17-4/h10-12,15H,5-9H2,1-4H3 |
| InChIKey | PQDOTLAGBQEFPG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|