C20H34O4 — CID 156679767
4-[3-[(Z)-dodec-2-enoyl]oxiran-2-yl]-2,2-dimethylbutanoic acid (PubChem CID 156679767) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 4-[3-[(Z)-dodec-2-enoyl]oxiran-2-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[3-[(Z)-dodec-2-enoyl]oxiran-2-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 156679767 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 4-[3-[(Z)-dodec-2-enoyl]oxiran-2-yl]-2,2-dimethylbutanoic acid |
| SMILES | CCCCCCCCC/C=C\C(=O)C1OC1CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H34O4/c1-4-5-6-7-8-9-10-11-12-13-16(21)18-17(24-18)14-15-20(2,3)19(22)23/h12-13,17-18H,4-11,14-15H2,1-3H3,(H,22,23)/b13-12- |
| InChIKey | BQLLYMJNOICNHG-SEYXRHQNSA-N |
| XLogP | 4.91 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|