C13H17BrO2 — CID 101194456
(5-bromo-2,4-dimethylphenyl) 2,2-dimethylpropanoate (PubChem CID 101194456) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is (5-bromo-2,4-dimethylphenyl) 2,2-dimethylpropanoate.
| Compound Name | (5-bromo-2,4-dimethylphenyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101194456 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (5-bromo-2,4-dimethylphenyl) 2,2-dimethylpropanoate |
| SMILES | Cc1cc(C)c(OC(=O)C(C)(C)C)cc1Br |
| InChI | InChI=1S/C13H17BrO2/c1-8-6-9(2)11(7-10(8)14)16-12(15)13(3,4)5/h6-7H,1-5H3 |
| InChIKey | YKBBNMGOEVWOFF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|