C20H30O3 — CID 101195772
(3S,3aS,5aS,8S,10aR,10bS)-3,8-dihydroxy-3a,5a,8-trimethyl-1-propan-2-yl-3,5,9,10,10a,10b-hexahydrocyclohepta[e]inden-4-one (PubChem CID 101195772) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3S,3aS,5aS,8S,10aR,10bS)-3,8-dihydroxy-3a,5a,8-trimethyl-1-propan-2-yl-3,5,9,10,10a,10b-hexahydrocyclohepta[e]inden-4-one.
| Compound Name | (3S,3aS,5aS,8S,10aR,10bS)-3,8-dihydroxy-3a,5a,8-trimethyl-1-propan-2-yl-3,5,9,10,10a,10b-hexahydrocyclohepta[e]inden-4-one |
|---|---|
| PubChem CID | 101195772 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3S,3aS,5aS,8S,10aR,10bS)-3,8-dihydroxy-3a,5a,8-trimethyl-1-propan-2-yl-3,5,9,10,10a,10b-hexahydrocyclohepta[e]inden-4-one |
| SMILES | CC(C)C1=C[C@H](O)[C@@]2(C)C(=O)C[C@@]3(C)C=C[C@@](C)(O)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H30O3/c1-12(2)13-10-15(21)20(5)16(22)11-18(3)8-9-19(4,23)7-6-14(18)17(13)20/h8-10,12,14-15,17,21,23H,6-7,11H2,1-5H3/t14-,15+,17-,18-,19+,20+/m1/s1 |
| InChIKey | ZHLWBJGJQXAWJN-WOHUTOPTSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|