C33H49NO6 — CID 101196150
tert-butyl (2S,4R)-4-[[(1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-13-propan-2-yl-1-prop-2-enoxycarbonyl-2-tetracyclo[7.4.0.02,11.04,8]tridec-12-enyl]methoxy]-2-methylpyrrolidine-1-carboxylate (PubChem CID 101196150) has the molecular formula C33H49NO6 and a molecular weight of 555.76 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[[(1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-13-propan-2-yl-1-prop-2-enoxycarbonyl-2-tetracyclo[7.4.0.02,11.04,8]tridec-12-enyl]methoxy]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[[(1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-13-propan-2-yl-1-prop-2-enoxycarbonyl-2-tetracyclo[7.4.0.02,11.04,8]tridec-12-enyl]methoxy]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101196150 |
| Molecular Formula | C33H49NO6 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | tert-butyl (2S,4R)-4-[[(1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-13-propan-2-yl-1-prop-2-enoxycarbonyl-2-tetracyclo[7.4.0.02,11.04,8]tridec-12-enyl]methoxy]-2-methylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@]12C(C(C)C)=C[C@H]3C[C@]1(C=O)[C@@H]1CC[C@@H](C)[C@H]1C[C@]32CO[C@@H]1C[C@H](C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C33H49NO6/c1-9-12-38-28(36)33-27(20(2)3)14-23-15-31(33,18-35)26-11-10-21(4)25(26)16-32(23,33)19-39-24-13-22(5)34(17-24)29(37)40-30(6,7)8/h9,14,18,20-26H,1,10-13,15-17,19H2,2-8H3/t21-,22+,23+,24-,25-,26-,31+,32+,33+/m1/s1 |
| InChIKey | LBZKVLXAJLAPFX-JJDSBWILSA-N |
| XLogP | 5.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|