C31H49KO6S — CID 101196972
potassium [(4aR,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-methoxycarbonyl-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] sulfate (PubChem CID 101196972) has the molecular formula C31H49KO6S and a molecular weight of 588.89 g/mol. Its IUPAC name is potassium [(4aR,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-methoxycarbonyl-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] sulfate.
| Compound Name | potassium [(4aR,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-methoxycarbonyl-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] sulfate |
|---|---|
| PubChem CID | 101196972 |
| Molecular Formula | C31H49KO6S |
| Molecular Weight | 588.89 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | potassium [(4aR,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-methoxycarbonyl-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] sulfate |
| SMILES | COC(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(OS(=O)(=O)[O-])C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1.[K+] |
| InChI | InChI=1S/C31H50O6S.K/c1-26(2)22-11-14-31(7)23(29(22,5)13-12-24(26)37-38(33,34)35)10-9-20-21-19-28(4,25(32)36-8)16-15-27(21,3)17-18-30(20,31)6;/h9,21-24H,10-19H2,1-8H3,(H,33,34,35);/q;+1/p-1/t21-,22-,23+,24?,27+,28-,29-,30+,31+;/m0./s1 |
| InChIKey | LCQFBLWIKYLINQ-JWFUJJKQSA-M |
| XLogP | 3.81 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|