C12H20F3NO2 — CID 101197525
N-[(1S,3S)-1-cyclohexyl-3-hydroxybutyl]-2,2,2-trifluoroacetamide (PubChem CID 101197525) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[(1S,3S)-1-cyclohexyl-3-hydroxybutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,3S)-1-cyclohexyl-3-hydroxybutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101197525 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-[(1S,3S)-1-cyclohexyl-3-hydroxybutyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](O)C[C@H](NC(=O)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H20F3NO2/c1-8(17)7-10(9-5-3-2-4-6-9)16-11(18)12(13,14)15/h8-10,17H,2-7H2,1H3,(H,16,18)/t8-,10-/m0/s1 |
| InChIKey | WOCHTJOBURVWLI-WPRPVWTQSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |