C19H34O2 — CID 101197919
(2S,6R)-2-(1-cyclohexylethenoxy)-6-hexyloxane (PubChem CID 101197919) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (2S,6R)-2-(1-cyclohexylethenoxy)-6-hexyloxane.
| Compound Name | (2S,6R)-2-(1-cyclohexylethenoxy)-6-hexyloxane |
|---|---|
| PubChem CID | 101197919 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (2S,6R)-2-(1-cyclohexylethenoxy)-6-hexyloxane |
| SMILES | C=C(O[C@H]1CCC[C@@H](CCCCCC)O1)C1CCCCC1 |
| InChI | InChI=1S/C19H34O2/c1-3-4-5-9-13-18-14-10-15-19(21-18)20-16(2)17-11-7-6-8-12-17/h17-19H,2-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | LBKMDTYPSIQSBL-RTBURBONSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|